C30H47NO9 — CID 66949381
(2S)-3-[3,4-bis(2,3-dimethylbutanoyloxy)phenyl]-2-[2-(3-methylbutan-2-yloxycarbonyloxy)propylamino]propanoic acid (PubChem CID 66949381) has the molecular formula C30H47NO9 and a molecular weight of 565.70 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(2,3-dimethylbutanoyloxy)phenyl]-2-[2-(3-methylbutan-2-yloxycarbonyloxy)propylamino]propanoic acid.
| Compound Name | (2S)-3-[3,4-bis(2,3-dimethylbutanoyloxy)phenyl]-2-[2-(3-methylbutan-2-yloxycarbonyloxy)propylamino]propanoic acid |
|---|---|
| PubChem CID | 66949381 |
| Molecular Formula | C30H47NO9 |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | (2S)-3-[3,4-bis(2,3-dimethylbutanoyloxy)phenyl]-2-[2-(3-methylbutan-2-yloxycarbonyloxy)propylamino]propanoic acid |
| SMILES | CC(CN[C@@H](Cc1ccc(OC(=O)C(C)C(C)C)c(OC(=O)C(C)C(C)C)c1)C(=O)O)OC(=O)OC(C)C(C)C |
| InChI | InChI=1S/C30H47NO9/c1-16(2)20(8)28(34)39-25-12-11-23(14-26(25)40-29(35)21(9)17(3)4)13-24(27(32)33)31-15-19(7)37-30(36)38-22(10)18(5)6/h11-12,14,16-22,24,31H,13,15H2,1-10H3,(H,32,33)/t19?,20?,21?,22?,24-/m0/s1 |
| InChIKey | WDJDIBRFNHMOPP-UDECNIMRSA-N |
| XLogP | 5.25 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|