C29H45NO10 — CID 66949839
1-[[(2S)-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl 2-methylpropanoate (PubChem CID 66949839) has the molecular formula C29H45NO10 and a molecular weight of 567.68 g/mol. Its IUPAC name is 1-[[(2S)-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl 2-methylpropanoate.
| Compound Name | 1-[[(2S)-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl 2-methylpropanoate |
|---|---|
| PubChem CID | 66949839 |
| Molecular Formula | C29H45NO10 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | 1-[[(2S)-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl 2-methylpropanoate |
| SMILES | CCC(C)COC(=O)Oc1ccc(C[C@H](NCC(C)OC(=O)C(C)C)C(=O)OC)cc1OC(=O)OCC(C)CC |
| InChI | InChI=1S/C29H45NO10/c1-9-19(5)16-36-28(33)39-24-12-11-22(14-25(24)40-29(34)37-17-20(6)10-2)13-23(27(32)35-8)30-15-21(7)38-26(31)18(3)4/h11-12,14,18-21,23,30H,9-10,13,15-17H2,1-8H3/t19?,20?,21?,23-/m0/s1 |
| InChIKey | PQTJOJYGKUZUGT-FTKYIGPGSA-N |
| XLogP | 5.07 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|