C24H35NO10 — CID 66950685
methyl (2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-2-(2-propanoyloxypropylamino)propanoate (PubChem CID 66950685) has the molecular formula C24H35NO10 and a molecular weight of 497.54 g/mol. Its IUPAC name is methyl (2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-2-(2-propanoyloxypropylamino)propanoate.
| Compound Name | methyl (2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-2-(2-propanoyloxypropylamino)propanoate |
|---|---|
| PubChem CID | 66950685 |
| Molecular Formula | C24H35NO10 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | methyl (2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-2-(2-propanoyloxypropylamino)propanoate |
| SMILES | CCCOC(=O)Oc1ccc(C[C@H](NCC(C)OC(=O)CC)C(=O)OC)cc1OC(=O)OCCC |
| InChI | InChI=1S/C24H35NO10/c1-6-11-31-23(28)34-19-10-9-17(14-20(19)35-24(29)32-12-7-2)13-18(22(27)30-5)25-15-16(4)33-21(26)8-3/h9-10,14,16,18,25H,6-8,11-13,15H2,1-5H3/t16?,18-/m0/s1 |
| InChIKey | LDHBIFDNRNHRFP-DAFXYXGESA-N |
| XLogP | 3.55 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|