C27H41NO9 — CID 66948516
[4-[(2S)-3-methoxy-3-oxo-2-(2-propoxycarbonyloxypropylamino)propyl]-2-pentanoyloxyphenyl] pentanoate (PubChem CID 66948516) has the molecular formula C27H41NO9 and a molecular weight of 523.62 g/mol. Its IUPAC name is [4-[(2S)-3-methoxy-3-oxo-2-(2-propoxycarbonyloxypropylamino)propyl]-2-pentanoyloxyphenyl] pentanoate.
| Compound Name | [4-[(2S)-3-methoxy-3-oxo-2-(2-propoxycarbonyloxypropylamino)propyl]-2-pentanoyloxyphenyl] pentanoate |
|---|---|
| PubChem CID | 66948516 |
| Molecular Formula | C27H41NO9 |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | [4-[(2S)-3-methoxy-3-oxo-2-(2-propoxycarbonyloxypropylamino)propyl]-2-pentanoyloxyphenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1ccc(C[C@H](NCC(C)OC(=O)OCCC)C(=O)OC)cc1OC(=O)CCCC |
| InChI | InChI=1S/C27H41NO9/c1-6-9-11-24(29)36-22-14-13-20(17-23(22)37-25(30)12-10-7-2)16-21(26(31)33-5)28-18-19(4)35-27(32)34-15-8-3/h13-14,17,19,21,28H,6-12,15-16,18H2,1-5H3/t19?,21-/m0/s1 |
| InChIKey | RKEDVVBYPMECHG-QWAKEFERSA-N |
| XLogP | 4.50 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|