C29H45NO9 — CID 66949690
[2-(2,2-dimethylpropanoyloxy)-4-[(2S)-3-methoxy-3-oxo-2-(2-pentoxycarbonyloxypropylamino)propyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 66949690) has the molecular formula C29H45NO9 and a molecular weight of 551.68 g/mol. Its IUPAC name is [2-(2,2-dimethylpropanoyloxy)-4-[(2S)-3-methoxy-3-oxo-2-(2-pentoxycarbonyloxypropylamino)propyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [2-(2,2-dimethylpropanoyloxy)-4-[(2S)-3-methoxy-3-oxo-2-(2-pentoxycarbonyloxypropylamino)propyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 66949690 |
| Molecular Formula | C29H45NO9 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | [2-(2,2-dimethylpropanoyloxy)-4-[(2S)-3-methoxy-3-oxo-2-(2-pentoxycarbonyloxypropylamino)propyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CCCCCOC(=O)OC(C)CN[C@@H](Cc1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1)C(=O)OC |
| InChI | InChI=1S/C29H45NO9/c1-10-11-12-15-36-27(34)37-19(2)18-30-21(24(31)35-9)16-20-13-14-22(38-25(32)28(3,4)5)23(17-20)39-26(33)29(6,7)8/h13-14,17,19,21,30H,10-12,15-16,18H2,1-9H3/t19?,21-/m0/s1 |
| InChIKey | WQMVGLWLCUSQNU-QWAKEFERSA-N |
| XLogP | 5.00 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|