C31H49NO11 — CID 66948525
methyl (2S)-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-2-(2-pentoxycarbonyloxypropylamino)propanoate (PubChem CID 66948525) has the molecular formula C31H49NO11 and a molecular weight of 611.73 g/mol. Its IUPAC name is methyl (2S)-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-2-(2-pentoxycarbonyloxypropylamino)propanoate.
| Compound Name | methyl (2S)-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-2-(2-pentoxycarbonyloxypropylamino)propanoate |
|---|---|
| PubChem CID | 66948525 |
| Molecular Formula | C31H49NO11 |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.33 |
| IUPAC Name | methyl (2S)-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-2-(2-pentoxycarbonyloxypropylamino)propanoate |
| SMILES | CCCCCOC(=O)OC(C)CN[C@@H](Cc1ccc(OC(=O)OC(C)C(C)C)c(OC(=O)OC(C)C(C)C)c1)C(=O)OC |
| InChI | InChI=1S/C31H49NO11/c1-10-11-12-15-38-29(34)39-21(6)18-32-25(28(33)37-9)16-24-13-14-26(42-30(35)40-22(7)19(2)3)27(17-24)43-31(36)41-23(8)20(4)5/h13-14,17,19-23,25,32H,10-12,15-16,18H2,1-9H3/t21?,22?,23?,25-/m0/s1 |
| InChIKey | QTNKWXNXMRRKLI-RIFKOICESA-N |
| XLogP | 6.21 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|