C29H45NO10 — CID 66943559
2-[[(2S)-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2-methylbutanoate (PubChem CID 66943559) has the molecular formula C29H45NO10 and a molecular weight of 567.68 g/mol. Its IUPAC name is 2-[[(2S)-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2-methylbutanoate.
| Compound Name | 2-[[(2S)-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 66943559 |
| Molecular Formula | C29H45NO10 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | 2-[[(2S)-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCN[C@@H](Cc1ccc(OC(=O)OC(C)C(C)C)c(OC(=O)OC(C)C(C)C)c1)C(=O)OC |
| InChI | InChI=1S/C29H45NO10/c1-10-19(6)26(31)36-14-13-30-23(27(32)35-9)15-22-11-12-24(39-28(33)37-20(7)17(2)3)25(16-22)40-29(34)38-21(8)18(4)5/h11-12,16-21,23,30H,10,13-15H2,1-9H3/t19?,20?,21?,23-/m0/s1 |
| InChIKey | LFPXRWSKKSXXBA-FTKYIGPGSA-N |
| XLogP | 5.07 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|