C25H37NO8 — CID 66944903
2-[[(2S)-3-[3,4-bis(2-methylpropanoyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2-methylbutanoate (PubChem CID 66944903) has the molecular formula C25H37NO8 and a molecular weight of 479.57 g/mol. Its IUPAC name is 2-[[(2S)-3-[3,4-bis(2-methylpropanoyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2-methylbutanoate.
| Compound Name | 2-[[(2S)-3-[3,4-bis(2-methylpropanoyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 66944903 |
| Molecular Formula | C25H37NO8 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 2-[[(2S)-3-[3,4-bis(2-methylpropanoyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCN[C@@H](Cc1ccc(OC(=O)C(C)C)c(OC(=O)C(C)C)c1)C(=O)OC |
| InChI | InChI=1S/C25H37NO8/c1-8-17(6)24(29)32-12-11-26-19(25(30)31-7)13-18-9-10-20(33-22(27)15(2)3)21(14-18)34-23(28)16(4)5/h9-10,14-17,19,26H,8,11-13H2,1-7H3/t17?,19-/m0/s1 |
| InChIKey | IKKVUIAUINJVGQ-NNBQYGFHSA-N |
| XLogP | 3.07 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|