C22H31NO11 — CID 66950597
methyl (2S)-3-[3,4-bis(methoxycarbonyloxy)phenyl]-2-[2-(2-methylbutoxycarbonyloxy)ethylamino]propanoate (PubChem CID 66950597) has the molecular formula C22H31NO11 and a molecular weight of 485.49 g/mol. Its IUPAC name is methyl (2S)-3-[3,4-bis(methoxycarbonyloxy)phenyl]-2-[2-(2-methylbutoxycarbonyloxy)ethylamino]propanoate.
| Compound Name | methyl (2S)-3-[3,4-bis(methoxycarbonyloxy)phenyl]-2-[2-(2-methylbutoxycarbonyloxy)ethylamino]propanoate |
|---|---|
| PubChem CID | 66950597 |
| Molecular Formula | C22H31NO11 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | methyl (2S)-3-[3,4-bis(methoxycarbonyloxy)phenyl]-2-[2-(2-methylbutoxycarbonyloxy)ethylamino]propanoate |
| SMILES | CCC(C)COC(=O)OCCN[C@@H](Cc1ccc(OC(=O)OC)c(OC(=O)OC)c1)C(=O)OC |
| InChI | InChI=1S/C22H31NO11/c1-6-14(2)13-32-22(27)31-10-9-23-16(19(24)28-3)11-15-7-8-17(33-20(25)29-4)18(12-15)34-21(26)30-5/h7-8,12,14,16,23H,6,9-11,13H2,1-5H3/t14?,16-/m0/s1 |
| InChIKey | UOWFFZNWTXZNHJ-WMCAAGNKSA-N |
| XLogP | 2.85 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|