C28H43NO10 — CID 66943681
2-[[(2S)-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3-methylpentanoate (PubChem CID 66943681) has the molecular formula C28H43NO10 and a molecular weight of 553.65 g/mol. Its IUPAC name is 2-[[(2S)-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3-methylpentanoate.
| Compound Name | 2-[[(2S)-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3-methylpentanoate |
|---|---|
| PubChem CID | 66943681 |
| Molecular Formula | C28H43NO10 |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | 2-[[(2S)-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3-methylpentanoate |
| SMILES | CCC(C)CC(=O)OCCN[C@@H](Cc1ccc(OC(=O)OCC(C)C)c(OC(=O)OCC(C)C)c1)C(=O)OC |
| InChI | InChI=1S/C28H43NO10/c1-8-20(6)13-25(30)35-12-11-29-22(26(31)34-7)14-21-9-10-23(38-27(32)36-16-18(2)3)24(15-21)39-28(33)37-17-19(4)5/h9-10,15,18-20,22,29H,8,11-14,16-17H2,1-7H3/t20?,22-/m0/s1 |
| InChIKey | MSAVQORLKSVPTA-IAXKEJLGSA-N |
| XLogP | 4.68 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|