C24H35NO11 — CID 66947946
methyl (2S)-3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-[2-(2-methylbutoxycarbonyloxy)ethylamino]propanoate (PubChem CID 66947946) has the molecular formula C24H35NO11 and a molecular weight of 513.54 g/mol. Its IUPAC name is methyl (2S)-3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-[2-(2-methylbutoxycarbonyloxy)ethylamino]propanoate.
| Compound Name | methyl (2S)-3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-[2-(2-methylbutoxycarbonyloxy)ethylamino]propanoate |
|---|---|
| PubChem CID | 66947946 |
| Molecular Formula | C24H35NO11 |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | methyl (2S)-3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-[2-(2-methylbutoxycarbonyloxy)ethylamino]propanoate |
| SMILES | CCOC(=O)Oc1ccc(C[C@H](NCCOC(=O)OCC(C)CC)C(=O)OC)cc1OC(=O)OCC |
| InChI | InChI=1S/C24H35NO11/c1-6-16(4)15-34-22(27)33-12-11-25-18(21(26)30-5)13-17-9-10-19(35-23(28)31-7-2)20(14-17)36-24(29)32-8-3/h9-10,14,16,18,25H,6-8,11-13,15H2,1-5H3/t16?,18-/m0/s1 |
| InChIKey | LRVQHSPUORKCDR-DAFXYXGESA-N |
| XLogP | 3.63 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|