C28H43NO9 — CID 66945083
[4-[(2S)-3-methoxy-3-oxo-2-(2-propoxycarbonyloxyethylamino)propyl]-2-(3-methylpentanoyloxy)phenyl] 3-methylpentanoate (PubChem CID 66945083) has the molecular formula C28H43NO9 and a molecular weight of 537.65 g/mol. Its IUPAC name is [4-[(2S)-3-methoxy-3-oxo-2-(2-propoxycarbonyloxyethylamino)propyl]-2-(3-methylpentanoyloxy)phenyl] 3-methylpentanoate.
| Compound Name | [4-[(2S)-3-methoxy-3-oxo-2-(2-propoxycarbonyloxyethylamino)propyl]-2-(3-methylpentanoyloxy)phenyl] 3-methylpentanoate |
|---|---|
| PubChem CID | 66945083 |
| Molecular Formula | C28H43NO9 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | [4-[(2S)-3-methoxy-3-oxo-2-(2-propoxycarbonyloxyethylamino)propyl]-2-(3-methylpentanoyloxy)phenyl] 3-methylpentanoate |
| SMILES | CCCOC(=O)OCCN[C@@H](Cc1ccc(OC(=O)CC(C)CC)c(OC(=O)CC(C)CC)c1)C(=O)OC |
| InChI | InChI=1S/C28H43NO9/c1-7-13-35-28(33)36-14-12-29-22(27(32)34-6)17-21-10-11-23(37-25(30)15-19(4)8-2)24(18-21)38-26(31)16-20(5)9-3/h10-11,18-20,22,29H,7-9,12-17H2,1-6H3/t19?,20?,22-/m0/s1 |
| InChIKey | PIFHTQQBOWSJKK-AOMIVXANSA-N |
| XLogP | 4.61 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|