C22H31NO9 — CID 66942814
methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-(2-pentoxycarbonyloxyethylamino)propanoate (PubChem CID 66942814) has the molecular formula C22H31NO9 and a molecular weight of 453.49 g/mol. Its IUPAC name is methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-(2-pentoxycarbonyloxyethylamino)propanoate.
| Compound Name | methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-(2-pentoxycarbonyloxyethylamino)propanoate |
|---|---|
| PubChem CID | 66942814 |
| Molecular Formula | C22H31NO9 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | methyl (2S)-3-(3,4-diacetyloxyphenyl)-2-(2-pentoxycarbonyloxyethylamino)propanoate |
| SMILES | CCCCCOC(=O)OCCN[C@@H](Cc1ccc(OC(C)=O)c(OC(C)=O)c1)C(=O)OC |
| InChI | InChI=1S/C22H31NO9/c1-5-6-7-11-29-22(27)30-12-10-23-18(21(26)28-4)13-17-8-9-19(31-15(2)24)20(14-17)32-16(3)25/h8-9,14,18,23H,5-7,10-13H2,1-4H3/t18-/m0/s1 |
| InChIKey | BKUZIFYQWKSZES-SFHVURJKSA-N |
| XLogP | 2.55 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|