C25H37NO10 — CID 66945197
2-[[(2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2-methylbutanoate (PubChem CID 66945197) has the molecular formula C25H37NO10 and a molecular weight of 511.57 g/mol. Its IUPAC name is 2-[[(2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2-methylbutanoate.
| Compound Name | 2-[[(2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 66945197 |
| Molecular Formula | C25H37NO10 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 2-[[(2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2-methylbutanoate |
| SMILES | CCCOC(=O)Oc1ccc(C[C@H](NCCOC(=O)C(C)CC)C(=O)OC)cc1OC(=O)OCCC |
| InChI | InChI=1S/C25H37NO10/c1-6-12-33-24(29)35-20-10-9-18(16-21(20)36-25(30)34-13-7-2)15-19(23(28)31-5)26-11-14-32-22(27)17(4)8-3/h9-10,16-17,19,26H,6-8,11-15H2,1-5H3/t17?,19-/m0/s1 |
| InChIKey | UFIYRCIRXPPLHU-NNBQYGFHSA-N |
| XLogP | 3.80 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|