C24H35NO8 — CID 66946346
2-[[(2S)-3-[3,4-di(propanoyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3-methylpentanoate (PubChem CID 66946346) has the molecular formula C24H35NO8 and a molecular weight of 465.54 g/mol. Its IUPAC name is 2-[[(2S)-3-[3,4-di(propanoyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3-methylpentanoate.
| Compound Name | 2-[[(2S)-3-[3,4-di(propanoyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3-methylpentanoate |
|---|---|
| PubChem CID | 66946346 |
| Molecular Formula | C24H35NO8 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 2-[[(2S)-3-[3,4-di(propanoyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3-methylpentanoate |
| SMILES | CCC(=O)Oc1ccc(C[C@H](NCCOC(=O)CC(C)CC)C(=O)OC)cc1OC(=O)CC |
| InChI | InChI=1S/C24H35NO8/c1-6-16(4)13-23(28)31-12-11-25-18(24(29)30-5)14-17-9-10-19(32-21(26)7-2)20(15-17)33-22(27)8-3/h9-10,15-16,18,25H,6-8,11-14H2,1-5H3/t16?,18-/m0/s1 |
| InChIKey | HXOFJDOIOLVTRR-DAFXYXGESA-N |
| XLogP | 2.97 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|