C22H31NO10 — CID 66946270
2-[[(2S)-3-[3,4-bis(methoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3,3-dimethylbutanoate (PubChem CID 66946270) has the molecular formula C22H31NO10 and a molecular weight of 469.49 g/mol. Its IUPAC name is 2-[[(2S)-3-[3,4-bis(methoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3,3-dimethylbutanoate.
| Compound Name | 2-[[(2S)-3-[3,4-bis(methoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 66946270 |
| Molecular Formula | C22H31NO10 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 2-[[(2S)-3-[3,4-bis(methoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3,3-dimethylbutanoate |
| SMILES | COC(=O)Oc1ccc(C[C@H](NCCOC(=O)CC(C)(C)C)C(=O)OC)cc1OC(=O)OC |
| InChI | InChI=1S/C22H31NO10/c1-22(2,3)13-18(24)31-10-9-23-15(19(25)28-4)11-14-7-8-16(32-20(26)29-5)17(12-14)33-21(27)30-6/h7-8,12,15,23H,9-11,13H2,1-6H3/t15-/m0/s1 |
| InChIKey | PKBCTFGDCGNIBE-HNNXBMFYSA-N |
| XLogP | 2.63 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|