C30H47NO10 — CID 66945840
2-[[(2S)-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3,3-dimethylbutanoate (PubChem CID 66945840) has the molecular formula C30H47NO10 and a molecular weight of 581.70 g/mol. Its IUPAC name is 2-[[(2S)-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3,3-dimethylbutanoate.
| Compound Name | 2-[[(2S)-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 66945840 |
| Molecular Formula | C30H47NO10 |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | 2-[[(2S)-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 3,3-dimethylbutanoate |
| SMILES | CCC(C)(C)OC(=O)Oc1ccc(C[C@H](NCCOC(=O)CC(C)(C)C)C(=O)OC)cc1OC(=O)OC(C)(C)CC |
| InChI | InChI=1S/C30H47NO10/c1-11-29(6,7)40-26(34)38-22-14-13-20(18-23(22)39-27(35)41-30(8,9)12-2)17-21(25(33)36-10)31-15-16-37-24(32)19-28(3,4)5/h13-14,18,21,31H,11-12,15-17,19H2,1-10H3/t21-/m0/s1 |
| InChIKey | VVFNQMXCOMYPDB-NRFANRHFSA-N |
| XLogP | 5.75 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|