C26H39NO10 — CID 66944848
2-[[(2S)-3-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl butanoate (PubChem CID 66944848) has the molecular formula C26H39NO10 and a molecular weight of 525.60 g/mol. Its IUPAC name is 2-[[(2S)-3-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl butanoate.
| Compound Name | 2-[[(2S)-3-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl butanoate |
|---|---|
| PubChem CID | 66944848 |
| Molecular Formula | C26H39NO10 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 2-[[(2S)-3-[3,4-bis[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl butanoate |
| SMILES | CCCC(=O)OCCN[C@@H](Cc1ccc(OC(=O)OC(C)(C)C)c(OC(=O)OC(C)(C)C)c1)C(=O)OC |
| InChI | InChI=1S/C26H39NO10/c1-9-10-21(28)33-14-13-27-18(22(29)32-8)15-17-11-12-19(34-23(30)36-25(2,3)4)20(16-17)35-24(31)37-26(5,6)7/h11-12,16,18,27H,9-10,13-15H2,1-8H3/t18-/m0/s1 |
| InChIKey | KQVJMBJSNITLHY-SFHVURJKSA-N |
| XLogP | 4.33 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|