C28H43NO10 — CID 66944938
2-[[(2S)-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl butanoate (PubChem CID 66944938) has the molecular formula C28H43NO10 and a molecular weight of 553.65 g/mol. Its IUPAC name is 2-[[(2S)-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl butanoate.
| Compound Name | 2-[[(2S)-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl butanoate |
|---|---|
| PubChem CID | 66944938 |
| Molecular Formula | C28H43NO10 |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | 2-[[(2S)-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl butanoate |
| SMILES | CCCC(=O)OCCN[C@@H](Cc1ccc(OC(=O)OC(C)CCC)c(OC(=O)OC(C)CCC)c1)C(=O)OC |
| InChI | InChI=1S/C28H43NO10/c1-7-10-19(4)36-27(32)38-23-14-13-21(18-24(23)39-28(33)37-20(5)11-8-2)17-22(26(31)34-6)29-15-16-35-25(30)12-9-3/h13-14,18-20,22,29H,7-12,15-17H2,1-6H3/t19?,20?,22-/m0/s1 |
| InChIKey | VWGMSABCIZGGGP-AOMIVXANSA-N |
| XLogP | 5.11 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|