C26H39NO10 — CID 66949824
methyl (2S)-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-2-(2-propanoyloxypropylamino)propanoate (PubChem CID 66949824) has the molecular formula C26H39NO10 and a molecular weight of 525.60 g/mol. Its IUPAC name is methyl (2S)-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-2-(2-propanoyloxypropylamino)propanoate.
| Compound Name | methyl (2S)-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-2-(2-propanoyloxypropylamino)propanoate |
|---|---|
| PubChem CID | 66949824 |
| Molecular Formula | C26H39NO10 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | methyl (2S)-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-2-(2-propanoyloxypropylamino)propanoate |
| SMILES | CCC(=O)OC(C)CN[C@@H](Cc1ccc(OC(=O)OCC(C)C)c(OC(=O)OCC(C)C)c1)C(=O)OC |
| InChI | InChI=1S/C26H39NO10/c1-8-23(28)35-18(6)13-27-20(24(29)32-7)11-19-9-10-21(36-25(30)33-14-16(2)3)22(12-19)37-26(31)34-15-17(4)5/h9-10,12,16-18,20,27H,8,11,13-15H2,1-7H3/t18?,20-/m0/s1 |
| InChIKey | DHNHAPIBRDATBG-IJHRGXPZSA-N |
| XLogP | 4.04 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|