C30H47NO10 — CID 66949290
1-[[(2S)-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl pentanoate (PubChem CID 66949290) has the molecular formula C30H47NO10 and a molecular weight of 581.70 g/mol. Its IUPAC name is 1-[[(2S)-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl pentanoate.
| Compound Name | 1-[[(2S)-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl pentanoate |
|---|---|
| PubChem CID | 66949290 |
| Molecular Formula | C30H47NO10 |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | 1-[[(2S)-3-[3,4-bis(2,2-dimethylpropoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl pentanoate |
| SMILES | CCCCC(=O)OC(C)CN[C@@H](Cc1ccc(OC(=O)OCC(C)(C)C)c(OC(=O)OCC(C)(C)C)c1)C(=O)OC |
| InChI | InChI=1S/C30H47NO10/c1-10-11-12-25(32)39-20(2)17-31-22(26(33)36-9)15-21-13-14-23(40-27(34)37-18-29(3,4)5)24(16-21)41-28(35)38-19-30(6,7)8/h13-14,16,20,22,31H,10-12,15,17-19H2,1-9H3/t20?,22-/m0/s1 |
| InChIKey | YAEWURMJACKGGP-IAXKEJLGSA-N |
| XLogP | 5.61 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|