C27H41NO10 — CID 66951919
1-[[(2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl 2-methylpentanoate (PubChem CID 66951919) has the molecular formula C27H41NO10 and a molecular weight of 539.62 g/mol. Its IUPAC name is 1-[[(2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl 2-methylpentanoate.
| Compound Name | 1-[[(2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl 2-methylpentanoate |
|---|---|
| PubChem CID | 66951919 |
| Molecular Formula | C27H41NO10 |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | 1-[[(2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl 2-methylpentanoate |
| SMILES | CCCOC(=O)Oc1ccc(C[C@H](NCC(C)OC(=O)C(C)CCC)C(=O)OC)cc1OC(=O)OCCC |
| InChI | InChI=1S/C27H41NO10/c1-7-10-18(4)24(29)36-19(5)17-28-21(25(30)33-6)15-20-11-12-22(37-26(31)34-13-8-2)23(16-20)38-27(32)35-14-9-3/h11-12,16,18-19,21,28H,7-10,13-15,17H2,1-6H3/t18?,19?,21-/m0/s1 |
| InChIKey | FZBJLNKUTJIWIZ-GRERDSQWSA-N |
| XLogP | 4.58 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|