C25H29NO9 — CID 66949423
(2S)-3-[3,4-di(propanoyloxy)phenyl]-2-(2-phenoxycarbonyloxypropylamino)propanoic acid (PubChem CID 66949423) has the molecular formula C25H29NO9 and a molecular weight of 487.51 g/mol. Its IUPAC name is (2S)-3-[3,4-di(propanoyloxy)phenyl]-2-(2-phenoxycarbonyloxypropylamino)propanoic acid.
| Compound Name | (2S)-3-[3,4-di(propanoyloxy)phenyl]-2-(2-phenoxycarbonyloxypropylamino)propanoic acid |
|---|---|
| PubChem CID | 66949423 |
| Molecular Formula | C25H29NO9 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | (2S)-3-[3,4-di(propanoyloxy)phenyl]-2-(2-phenoxycarbonyloxypropylamino)propanoic acid |
| SMILES | CCC(=O)Oc1ccc(C[C@H](NCC(C)OC(=O)Oc2ccccc2)C(=O)O)cc1OC(=O)CC |
| InChI | InChI=1S/C25H29NO9/c1-4-22(27)34-20-12-11-17(14-21(20)35-23(28)5-2)13-19(24(29)30)26-15-16(3)32-25(31)33-18-9-7-6-8-10-18/h6-12,14,16,19,26H,4-5,13,15H2,1-3H3,(H,29,30)/t16?,19-/m0/s1 |
| InChIKey | VNVGKDDKACLJJX-CVMIBEPCSA-N |
| XLogP | 3.51 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|