C26H31NO10 — CID 66942754
[(4S)-4-amino-4-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-5-methoxy-5-oxopentan-2-yl] benzoate (PubChem CID 66942754) has the molecular formula C26H31NO10 and a molecular weight of 517.53 g/mol. Its IUPAC name is [(4S)-4-amino-4-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-5-methoxy-5-oxopentan-2-yl] benzoate.
| Compound Name | [(4S)-4-amino-4-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-5-methoxy-5-oxopentan-2-yl] benzoate |
|---|---|
| PubChem CID | 66942754 |
| Molecular Formula | C26H31NO10 |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | [(4S)-4-amino-4-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-5-methoxy-5-oxopentan-2-yl] benzoate |
| SMILES | CCOC(=O)Oc1ccc(C[C@](N)(CC(C)OC(=O)c2ccccc2)C(=O)OC)cc1OC(=O)OCC |
| InChI | InChI=1S/C26H31NO10/c1-5-33-24(30)36-20-13-12-18(14-21(20)37-25(31)34-6-2)16-26(27,23(29)32-4)15-17(3)35-22(28)19-10-8-7-9-11-19/h7-14,17H,5-6,15-16,27H2,1-4H3/t17?,26-/m1/s1 |
| InChIKey | XCBKESRSRIICDF-XJCVEMOTSA-N |
| XLogP | 3.81 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|