C23H20F6O6 — CID 91752056
[4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxoethyl]-2-propanoyloxyphenyl] propanoate (PubChem CID 91752056) has the molecular formula C23H20F6O6 and a molecular weight of 506.40 g/mol. Its IUPAC name is [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxoethyl]-2-propanoyloxyphenyl] propanoate.
| Compound Name | [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxoethyl]-2-propanoyloxyphenyl] propanoate |
|---|---|
| PubChem CID | 91752056 |
| Molecular Formula | C23H20F6O6 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | [4-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-oxoethyl]-2-propanoyloxyphenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(CC(=O)OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1OC(=O)CC |
| InChI | InChI=1S/C23H20F6O6/c1-3-19(30)34-17-6-5-13(9-18(17)35-20(31)4-2)10-21(32)33-12-14-7-15(22(24,25)26)11-16(8-14)23(27,28)29/h5-9,11H,3-4,10,12H2,1-2H3 |
| InChIKey | RBSZVXQBUCQJFA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|