C15H19NO6 — CID 69169012
(2S)-2-amino-2-[3,4-di(propanoyloxy)phenyl]propanoic acid (PubChem CID 69169012) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2S)-2-amino-2-[3,4-di(propanoyloxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-2-[3,4-di(propanoyloxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 69169012 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2S)-2-amino-2-[3,4-di(propanoyloxy)phenyl]propanoic acid |
| SMILES | CCC(=O)Oc1ccc([C@](C)(N)C(=O)O)cc1OC(=O)CC |
| InChI | InChI=1S/C15H19NO6/c1-4-12(17)21-10-7-6-9(15(3,16)14(19)20)8-11(10)22-13(18)5-2/h6-8H,4-5,16H2,1-3H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | TXNBVJKSSKSDBH-HNNXBMFYSA-N |
| XLogP | 1.58 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|