C11H15NO3 — CID 82098466
2-amino-2-(4-methoxy-3-methylphenyl)propanoic acid (PubChem CID 82098466) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 2-amino-2-(4-methoxy-3-methylphenyl)propanoic acid.
| Compound Name | 2-amino-2-(4-methoxy-3-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 82098466 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2-amino-2-(4-methoxy-3-methylphenyl)propanoic acid |
| SMILES | COc1ccc(C(C)(N)C(=O)O)cc1C |
| InChI | InChI=1S/C11H15NO3/c1-7-6-8(4-5-9(7)15-3)11(2,12)10(13)14/h4-6H,12H2,1-3H3,(H,13,14) |
| InChIKey | PSCZURPONJGKCX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |