C12H17NO3 — CID 165354727
(2S)-2-amino-2-(2-methoxy-4,6-dimethylphenyl)propanoic acid (PubChem CID 165354727) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (2S)-2-amino-2-(2-methoxy-4,6-dimethylphenyl)propanoic acid.
| Compound Name | (2S)-2-amino-2-(2-methoxy-4,6-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 165354727 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (2S)-2-amino-2-(2-methoxy-4,6-dimethylphenyl)propanoic acid |
| SMILES | COc1cc(C)cc(C)c1[C@](C)(N)C(=O)O |
| InChI | InChI=1S/C12H17NO3/c1-7-5-8(2)10(9(6-7)16-4)12(3,13)11(14)15/h5-6H,13H2,1-4H3,(H,14,15)/t12-/m0/s1 |
| InChIKey | ZXOPKBADAIQDTF-LBPRGKRZSA-N |
| XLogP | 1.57 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |