3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid

C14H20O4 — CID 117384014

IUPAC3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid
SMILESCOc1cc(C)c(C(C)(C)CC(=O)O)c(OC)c1
InChIInChI=1S/C14H20O4/c1-9-6-10(17-4)7-11(18-5)13(9)14(2,3)8-12(15)16/h6-7H,8H2,1-5H3,(H,15,16)
InChIKeySFRYGAXPVZLFTB-UHFFFAOYSA-N
MW252.31 g/mol
LogP2.76
Rot. Bonds5

About 3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid

3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid (PubChem CID 117384014) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid.

Molecular Properties

Compound Name3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid
PubChem CID117384014
Molecular FormulaC14H20O4
Molecular Weight252.31 g/mol
Exact Mass252.14
IUPAC Name3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid
SMILESCOc1cc(C)c(C(C)(C)CC(=O)O)c(OC)c1
InChIInChI=1S/C14H20O4/c1-9-6-10(17-4)7-11(18-5)13(9)14(2,3)8-12(15)16/h6-7H,8H2,1-5H3,(H,15,16)
InChIKeySFRYGAXPVZLFTB-UHFFFAOYSA-N
XLogP2.76
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.31
LogP ≤ 52.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid?
The IUPAC name of 3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid (CID 117384014) is 3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid.
What is the SMILES notation for 3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid?
The canonical SMILES for 3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid is COc1cc(C)c(C(C)(C)CC(=O)O)c(OC)c1.
What is the InChIKey of 3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid?
The InChIKey is SFRYGAXPVZLFTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c1-9-6-10(17-4)7-11(18-5)13(9)14(2,3)8-12(15)16/h6-7H,8H2,1-5H3,(H,15,16).
What are the key properties of 3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid?
3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid has a molecular weight of 252.31 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethoxy-6-methylphenyl)-3-methylbutanoic acid is sourced from PubChem (CID 117384014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).