C16H23NO4 — CID 10501488
3-[2-(3-aminopropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoic acid (PubChem CID 10501488) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 3-[2-(3-aminopropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoic acid.
| Compound Name | 3-[2-(3-aminopropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 10501488 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-[2-(3-aminopropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanoic acid |
| SMILES | Cc1cc(C)c(C(C)(C)CC(=O)O)c(OC(=O)CCN)c1 |
| InChI | InChI=1S/C16H23NO4/c1-10-7-11(2)15(16(3,4)9-13(18)19)12(8-10)21-14(20)5-6-17/h7-8H,5-6,9,17H2,1-4H3,(H,18,19) |
| InChIKey | HKMBOSIXTVHBCS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|