C13H17O4P — CID 23575529
3-(2,4-dimethyl-6-phosphorosooxyphenyl)-3-methylbutanoic acid (PubChem CID 23575529) has the molecular formula C13H17O4P and a molecular weight of 268.25 g/mol. Its IUPAC name is 3-(2,4-dimethyl-6-phosphorosooxyphenyl)-3-methylbutanoic acid.
| Compound Name | 3-(2,4-dimethyl-6-phosphorosooxyphenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 23575529 |
| Molecular Formula | C13H17O4P |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 3-(2,4-dimethyl-6-phosphorosooxyphenyl)-3-methylbutanoic acid |
| SMILES | Cc1cc(C)c(C(C)(C)CC(=O)O)c(OP=O)c1 |
| InChI | InChI=1S/C13H17O4P/c1-8-5-9(2)12(10(6-8)17-18-16)13(3,4)7-11(14)15/h5-6H,7H2,1-4H3,(H,14,15) |
| InChIKey | ZKKPKINDEVDLEI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|