C16H25O5P — CID 140959277
[2-(2,5-dimethyl-4-oxohexan-2-yl)-3,5-dimethylphenyl] dihydrogen phosphate (PubChem CID 140959277) has the molecular formula C16H25O5P and a molecular weight of 328.35 g/mol. Its IUPAC name is [2-(2,5-dimethyl-4-oxohexan-2-yl)-3,5-dimethylphenyl] dihydrogen phosphate.
| Compound Name | [2-(2,5-dimethyl-4-oxohexan-2-yl)-3,5-dimethylphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 140959277 |
| Molecular Formula | C16H25O5P |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | [2-(2,5-dimethyl-4-oxohexan-2-yl)-3,5-dimethylphenyl] dihydrogen phosphate |
| SMILES | Cc1cc(C)c(C(C)(C)CC(=O)C(C)C)c(OP(=O)(O)O)c1 |
| InChI | InChI=1S/C16H25O5P/c1-10(2)13(17)9-16(5,6)15-12(4)7-11(3)8-14(15)21-22(18,19)20/h7-8,10H,9H2,1-6H3,(H2,18,19,20) |
| InChIKey | NMGORCAHDRVDKV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|