C15H20O3 — CID 171526449
[3,5-dimethyl-2-(2-methyl-4-oxopentan-2-yl)phenyl] formate (PubChem CID 171526449) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is [3,5-dimethyl-2-(2-methyl-4-oxopentan-2-yl)phenyl] formate.
| Compound Name | [3,5-dimethyl-2-(2-methyl-4-oxopentan-2-yl)phenyl] formate |
|---|---|
| PubChem CID | 171526449 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [3,5-dimethyl-2-(2-methyl-4-oxopentan-2-yl)phenyl] formate |
| SMILES | CC(=O)CC(C)(C)c1c(C)cc(C)cc1OC=O |
| InChI | InChI=1S/C15H20O3/c1-10-6-11(2)14(13(7-10)18-9-16)15(4,5)8-12(3)17/h6-7,9H,8H2,1-5H3 |
| InChIKey | FDADONIAXOJSAY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|