C18H28O3 — CID 145016623
[3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] propanoate;ethane (PubChem CID 145016623) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] propanoate;ethane.
| Compound Name | [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] propanoate;ethane |
|---|---|
| PubChem CID | 145016623 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] propanoate;ethane |
| SMILES | CC.CCC(=O)Oc1cc(C)cc(C)c1C(C)(C)CC=O |
| InChI | InChI=1S/C16H22O3.C2H6/c1-6-14(18)19-13-10-11(2)9-12(3)15(13)16(4,5)7-8-17;1-2/h8-10H,6-7H2,1-5H3;1-2H3 |
| InChIKey | OIRDBAHBULWVBF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|