C18H25NaO3S — CID 159986070
sodium 3-[2-(2,2-dimethylpropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanethioate (PubChem CID 159986070) has the molecular formula C18H25NaO3S and a molecular weight of 344.45 g/mol. Its IUPAC name is sodium 3-[2-(2,2-dimethylpropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanethioate.
| Compound Name | sodium 3-[2-(2,2-dimethylpropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanethioate |
|---|---|
| PubChem CID | 159986070 |
| Molecular Formula | C18H25NaO3S |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | sodium 3-[2-(2,2-dimethylpropanoyloxy)-4,6-dimethylphenyl]-3-methylbutanethioate |
| SMILES | Cc1cc(C)c(C(C)(C)CC([O-])=S)c(OC(=O)C(C)(C)C)c1.[Na+] |
| InChI | InChI=1S/C18H26O3S.Na/c1-11-8-12(2)15(18(6,7)10-14(19)22)13(9-11)21-16(20)17(3,4)5;/h8-9H,10H2,1-7H3,(H,19,22);/q;+1/p-1 |
| InChIKey | OGISPEQWLCBQBJ-UHFFFAOYSA-M |
| XLogP | 0.61 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|