About 5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one
5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one (PubChem CID 122674449) has the molecular formula C19H30O2
and a molecular weight of 290.45 g/mol. Its IUPAC name is 5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one.
Molecular Properties
| Compound Name | 5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one |
| PubChem CID | 122674449 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one |
| SMILES | Cc1cc(C)c(C(C)(C)CC(=O)C(C)C)c(OC(C)C)c1 |
| InChI | InChI=1S/C19H30O2/c1-12(2)16(20)11-19(7,8)18-15(6)9-14(5)10-17(18)21-13(3)4/h9-10,12-13H,11H2,1-8H3 |
| InChIKey | QWCCQYCXQOSHCP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one?
The IUPAC name of 5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one (CID 122674449) is 5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one.
What is the SMILES notation for 5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one?
The canonical SMILES for 5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one is Cc1cc(C)c(C(C)(C)CC(=O)C(C)C)c(OC(C)C)c1.
What is the InChIKey of 5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one?
The InChIKey is QWCCQYCXQOSHCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O2/c1-12(2)16(20)11-19(7,8)18-15(6)9-14(5)10-17(18)21-13(3)4/h9-10,12-13H,11H2,1-8H3.
What are the key properties of 5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one?
5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one has a molecular weight of 290.45 g/mol, XLogP of 4.98, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dimethyl-6-propan-2-yloxyphenyl)-2,5-dimethylhexan-3-one is sourced from PubChem (CID 122674449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).