C15H23O5P — CID 90395423
[2-(2,5-dimethyl-4-oxohexan-2-yl)-3-methylphenyl] dihydrogen phosphate (PubChem CID 90395423) has the molecular formula C15H23O5P and a molecular weight of 314.32 g/mol. Its IUPAC name is [2-(2,5-dimethyl-4-oxohexan-2-yl)-3-methylphenyl] dihydrogen phosphate.
| Compound Name | [2-(2,5-dimethyl-4-oxohexan-2-yl)-3-methylphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90395423 |
| Molecular Formula | C15H23O5P |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [2-(2,5-dimethyl-4-oxohexan-2-yl)-3-methylphenyl] dihydrogen phosphate |
| SMILES | Cc1cccc(OP(=O)(O)O)c1C(C)(C)CC(=O)C(C)C |
| InChI | InChI=1S/C15H23O5P/c1-10(2)12(16)9-15(4,5)14-11(3)7-6-8-13(14)20-21(17,18)19/h6-8,10H,9H2,1-5H3,(H2,17,18,19) |
| InChIKey | JPOVTONTWAFUBZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|