About [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate
[3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate (PubChem CID 89417723) has the molecular formula C15H24NO4P
and a molecular weight of 313.33 g/mol. Its IUPAC name is [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate |
| PubChem CID | 89417723 |
| Molecular Formula | C15H24NO4P |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate |
| SMILES | C=C(CC(C)(C)c1c(C)cc(C)cc1OP(=O)(O)O)NC |
| InChI | InChI=1S/C15H24NO4P/c1-10-7-11(2)14(13(8-10)20-21(17,18)19)15(4,5)9-12(3)16-6/h7-8,16H,3,9H2,1-2,4-6H3,(H2,17,18,19) |
| InChIKey | BEEYDBJHTRBBFH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate?
The IUPAC name of [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate (CID 89417723) is [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate.
What is the SMILES notation for [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate?
The canonical SMILES for [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate is C=C(CC(C)(C)c1c(C)cc(C)cc1OP(=O)(O)O)NC.
What is the InChIKey of [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate?
The InChIKey is BEEYDBJHTRBBFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24NO4P/c1-10-7-11(2)14(13(8-10)20-21(17,18)19)15(4,5)9-12(3)16-6/h7-8,16H,3,9H2,1-2,4-6H3,(H2,17,18,19).
What are the key properties of [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate?
[3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate has a molecular weight of 313.33 g/mol, XLogP of 3.18, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate is sourced from PubChem (CID 89417723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).