C15H24NO4P — CID 89417723
[3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate (PubChem CID 89417723) has the molecular formula C15H24NO4P and a molecular weight of 313.33 g/mol. Its IUPAC name is [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate.
| Compound Name | [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 89417723 |
| Molecular Formula | C15H24NO4P |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | [3,5-dimethyl-2-[2-methyl-4-(methylamino)pent-4-en-2-yl]phenyl] dihydrogen phosphate |
| SMILES | C=C(CC(C)(C)c1c(C)cc(C)cc1OP(=O)(O)O)NC |
| InChI | InChI=1S/C15H24NO4P/c1-10-7-11(2)14(13(8-10)20-21(17,18)19)15(4,5)9-12(3)16-6/h7-8,16H,3,9H2,1-2,4-6H3,(H2,17,18,19) |
| InChIKey | BEEYDBJHTRBBFH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|