C14H17HgO4 — CID 153400800
[2-(1-carboxy-2-methylpropan-2-yl)-3,5-dimethylphenoxy]carbonylmercury (PubChem CID 153400800) has the molecular formula C14H17HgO4 and a molecular weight of 449.88 g/mol. Its IUPAC name is [2-(1-carboxy-2-methylpropan-2-yl)-3,5-dimethylphenoxy]carbonylmercury.
| Compound Name | [2-(1-carboxy-2-methylpropan-2-yl)-3,5-dimethylphenoxy]carbonylmercury |
|---|---|
| PubChem CID | 153400800 |
| Molecular Formula | C14H17HgO4 |
| Molecular Weight | 449.88 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | [2-(1-carboxy-2-methylpropan-2-yl)-3,5-dimethylphenoxy]carbonylmercury |
| SMILES | Cc1cc(C)c(C(C)(C)CC(=O)O)c(OC(=O)[Hg])c1 |
| InChI | InChI=1S/C14H17O4.Hg/c1-9-5-10(2)13(11(6-9)18-8-15)14(3,4)7-12(16)17;/h5-6H,7H2,1-4H3,(H,16,17); |
| InChIKey | BNVJBVFNFFKSJO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.88 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|