C15H19NaO3S — CID 140866927
sodium 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanethioate (PubChem CID 140866927) has the molecular formula C15H19NaO3S and a molecular weight of 302.37 g/mol. Its IUPAC name is sodium 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanethioate.
| Compound Name | sodium 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanethioate |
|---|---|
| PubChem CID | 140866927 |
| Molecular Formula | C15H19NaO3S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | sodium 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanethioate |
| SMILES | CC(=O)Oc1cc(C)cc(C)c1C(C)(C)CC([O-])=S.[Na+] |
| InChI | InChI=1S/C15H20O3S.Na/c1-9-6-10(2)14(12(7-9)18-11(3)16)15(4,5)8-13(17)19;/h6-7H,8H2,1-5H3,(H,17,19);/q;+1/p-1 |
| InChIKey | LWLHXZAHWAFNMX-UHFFFAOYSA-M |
| XLogP | -0.41 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|