C20H24O5 — CID 175837302
furan-2-ylmethyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate (PubChem CID 175837302) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is furan-2-ylmethyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate.
| Compound Name | furan-2-ylmethyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 175837302 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | furan-2-ylmethyl 3-(2-acetyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
| SMILES | CC(=O)Oc1cc(C)cc(C)c1C(C)(C)CC(=O)OCc1ccco1 |
| InChI | InChI=1S/C20H24O5/c1-13-9-14(2)19(17(10-13)25-15(3)21)20(4,5)11-18(22)24-12-16-7-6-8-23-16/h6-10H,11-12H2,1-5H3 |
| InChIKey | TYPOZOFZILGMJW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|