C17H27O5P — CID 176979371
2-methylpropyl 3-(2-dihydroxyphosphanyloxy-4,6-dimethylphenyl)-3-methylbutanoate (PubChem CID 176979371) has the molecular formula C17H27O5P and a molecular weight of 342.37 g/mol. Its IUPAC name is 2-methylpropyl 3-(2-dihydroxyphosphanyloxy-4,6-dimethylphenyl)-3-methylbutanoate.
| Compound Name | 2-methylpropyl 3-(2-dihydroxyphosphanyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 176979371 |
| Molecular Formula | C17H27O5P |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2-methylpropyl 3-(2-dihydroxyphosphanyloxy-4,6-dimethylphenyl)-3-methylbutanoate |
| SMILES | Cc1cc(C)c(C(C)(C)CC(=O)OCC(C)C)c(OP(O)O)c1 |
| InChI | InChI=1S/C17H27O5P/c1-11(2)10-21-15(18)9-17(5,6)16-13(4)7-12(3)8-14(16)22-23(19)20/h7-8,11,19-20H,9-10H2,1-6H3 |
| InChIKey | DSWRQPFOWVPKQZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|