C14H19ClO2S — CID 142619404
chloromethyl 3-(2,4-dimethyl-6-sulfanylphenyl)-3-methylbutanoate (PubChem CID 142619404) has the molecular formula C14H19ClO2S and a molecular weight of 286.82 g/mol. Its IUPAC name is chloromethyl 3-(2,4-dimethyl-6-sulfanylphenyl)-3-methylbutanoate.
| Compound Name | chloromethyl 3-(2,4-dimethyl-6-sulfanylphenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 142619404 |
| Molecular Formula | C14H19ClO2S |
| Molecular Weight | 286.82 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | chloromethyl 3-(2,4-dimethyl-6-sulfanylphenyl)-3-methylbutanoate |
| SMILES | Cc1cc(C)c(C(C)(C)CC(=O)OCCl)c(S)c1 |
| InChI | InChI=1S/C14H19ClO2S/c1-9-5-10(2)13(11(18)6-9)14(3,4)7-12(16)17-8-15/h5-6,18H,7-8H2,1-4H3 |
| InChIKey | BFIAQGRPSLVEEZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|