C18H26O2 — CID 153346340
4-[2,4-dimethyl-6-(2-methylprop-2-enoxy)phenyl]-4-methylpentan-2-one (PubChem CID 153346340) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 4-[2,4-dimethyl-6-(2-methylprop-2-enoxy)phenyl]-4-methylpentan-2-one.
| Compound Name | 4-[2,4-dimethyl-6-(2-methylprop-2-enoxy)phenyl]-4-methylpentan-2-one |
|---|---|
| PubChem CID | 153346340 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 4-[2,4-dimethyl-6-(2-methylprop-2-enoxy)phenyl]-4-methylpentan-2-one |
| SMILES | C=C(C)COc1cc(C)cc(C)c1C(C)(C)CC(C)=O |
| InChI | InChI=1S/C18H26O2/c1-12(2)11-20-16-9-13(3)8-14(4)17(16)18(6,7)10-15(5)19/h8-9H,1,10-11H2,2-7H3 |
| InChIKey | ZLPOCWFXVUHSHL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|