C23H35NO8 — CID 10789852
3-[2,4-dimethyl-6-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxycarbonyloxy]phenyl]-3-methylbutanoic acid (PubChem CID 10789852) has the molecular formula C23H35NO8 and a molecular weight of 453.53 g/mol. Its IUPAC name is 3-[2,4-dimethyl-6-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxycarbonyloxy]phenyl]-3-methylbutanoic acid.
| Compound Name | 3-[2,4-dimethyl-6-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxycarbonyloxy]phenyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 10789852 |
| Molecular Formula | C23H35NO8 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 3-[2,4-dimethyl-6-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxycarbonyloxy]phenyl]-3-methylbutanoic acid |
| SMILES | Cc1cc(C)c(C(C)(C)CC(=O)O)c(OC(=O)OCCOCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H35NO8/c1-15-12-16(2)19(23(6,7)14-18(25)26)17(13-15)31-21(28)30-11-10-29-9-8-24-20(27)32-22(3,4)5/h12-13H,8-11,14H2,1-7H3,(H,24,27)(H,25,26) |
| InChIKey | FQZZAOGFYTUTJZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|