C13H27NO6 — CID 142814707
ethane;2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid (PubChem CID 142814707) has the molecular formula C13H27NO6 and a molecular weight of 293.36 g/mol. Its IUPAC name is ethane;2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid.
| Compound Name | ethane;2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 142814707 |
| Molecular Formula | C13H27NO6 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | ethane;2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid |
| SMILES | CC.CC(C)(C)OC(=O)NCCOCCOCC(=O)O |
| InChI | InChI=1S/C11H21NO6.C2H6/c1-11(2,3)18-10(15)12-4-5-16-6-7-17-8-9(13)14;1-2/h4-8H2,1-3H3,(H,12,15)(H,13,14);1-2H3 |
| InChIKey | XSXKIMSMAHFWSL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|