C14H27NO8 — CID 166714895
2-[2-[2-hydroxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propoxy]ethoxy]acetic acid (PubChem CID 166714895) has the molecular formula C14H27NO8 and a molecular weight of 337.37 g/mol. Its IUPAC name is 2-[2-[2-hydroxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-hydroxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 166714895 |
| Molecular Formula | C14H27NO8 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-[2-[2-hydroxy-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propoxy]ethoxy]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCCOCC(O)COCCOCC(=O)O |
| InChI | InChI=1S/C14H27NO8/c1-14(2,3)23-13(19)15-4-5-20-8-11(16)9-21-6-7-22-10-12(17)18/h11,16H,4-10H2,1-3H3,(H,15,19)(H,17,18) |
| InChIKey | LXTCKHJKBBFBCS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|