C15H29NO8 — CID 166714903
2-[2-[2-[3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]ethoxy]ethoxy]acetic acid (PubChem CID 166714903) has the molecular formula C15H29NO8 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-[2-[2-[3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 166714903 |
| Molecular Formula | C15H29NO8 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 2-[2-[2-[3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]ethoxy]ethoxy]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCC(O)CCOCCOCCOCC(=O)O |
| InChI | InChI=1S/C15H29NO8/c1-15(2,3)24-14(20)16-10-12(17)4-5-21-6-7-22-8-9-23-11-13(18)19/h12,17H,4-11H2,1-3H3,(H,16,20)(H,18,19) |
| InChIKey | FGSUZWINJJNYDG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|