C18H33NO9 — CID 87434108
2-[2-[5-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]-4-oxopentoxy]ethoxy]acetic acid (PubChem CID 87434108) has the molecular formula C18H33NO9 and a molecular weight of 407.46 g/mol. Its IUPAC name is 2-[2-[5-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]-4-oxopentoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[5-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]-4-oxopentoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 87434108 |
| Molecular Formula | C18H33NO9 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 2-[2-[5-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]-4-oxopentoxy]ethoxy]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCC(=O)CCCOCCOCC(=O)O |
| InChI | InChI=1S/C18H33NO9/c1-18(2,3)28-17(23)19-6-8-25-10-11-26-13-15(20)5-4-7-24-9-12-27-14-16(21)22/h4-14H2,1-3H3,(H,19,23)(H,21,22) |
| InChIKey | OVLOHGMJXHZSJD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|