C10H19NO4 — CID 163823990
tert-butyl N-[2-(2-hydroxyprop-2-enoxy)ethyl]carbamate (PubChem CID 163823990) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is tert-butyl N-[2-(2-hydroxyprop-2-enoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-hydroxyprop-2-enoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 163823990 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | tert-butyl N-[2-(2-hydroxyprop-2-enoxy)ethyl]carbamate |
| SMILES | C=C(O)COCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19NO4/c1-8(12)7-14-6-5-11-9(13)15-10(2,3)4/h12H,1,5-7H2,2-4H3,(H,11,13) |
| InChIKey | NXVKHXSUIXIQJE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|